About [2-[[1-(3,3,3-trifluoropropyl)piperidin-4-yl]amino]cycloheptyl]methanol
[2-[[1-(3,3,3-trifluoropropyl)piperidin-4-yl]amino]cycloheptyl]methanol (PubChem CID 86785650) has the molecular formula C16H29F3N2O
and a molecular weight of 322.42 g/mol. Its IUPAC name is [2-[[1-(3,3,3-trifluoropropyl)piperidin-4-yl]amino]cycloheptyl]methanol.
Molecular Properties
| Compound Name | [2-[[1-(3,3,3-trifluoropropyl)piperidin-4-yl]amino]cycloheptyl]methanol |
| PubChem CID | 86785650 |
| Molecular Formula | C16H29F3N2O |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | [2-[[1-(3,3,3-trifluoropropyl)piperidin-4-yl]amino]cycloheptyl]methanol |
| SMILES | OCC1CCCCCC1NC1CCN(CCC(F)(F)F)CC1 |
| InChI | InChI=1S/C16H29F3N2O/c17-16(18,19)8-11-21-9-6-14(7-10-21)20-15-5-3-1-2-4-13(15)12-22/h13-15,20,22H,1-12H2 |
| InChIKey | KEDSNRCFWQDXGS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-[[1-(3,3,3-trifluoropropyl)piperidin-4-yl]amino]cycloheptyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[1-(3,3,3-trifluoropropyl)piperidin-4-yl]amino]cycloheptyl]methanol?
The IUPAC name of [2-[[1-(3,3,3-trifluoropropyl)piperidin-4-yl]amino]cycloheptyl]methanol (CID 86785650) is [2-[[1-(3,3,3-trifluoropropyl)piperidin-4-yl]amino]cycloheptyl]methanol.
What is the SMILES notation for [2-[[1-(3,3,3-trifluoropropyl)piperidin-4-yl]amino]cycloheptyl]methanol?
The canonical SMILES for [2-[[1-(3,3,3-trifluoropropyl)piperidin-4-yl]amino]cycloheptyl]methanol is OCC1CCCCCC1NC1CCN(CCC(F)(F)F)CC1.
What is the InChIKey of [2-[[1-(3,3,3-trifluoropropyl)piperidin-4-yl]amino]cycloheptyl]methanol?
The InChIKey is KEDSNRCFWQDXGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29F3N2O/c17-16(18,19)8-11-21-9-6-14(7-10-21)20-15-5-3-1-2-4-13(15)12-22/h13-15,20,22H,1-12H2.
What are the key properties of [2-[[1-(3,3,3-trifluoropropyl)piperidin-4-yl]amino]cycloheptyl]methanol?
[2-[[1-(3,3,3-trifluoropropyl)piperidin-4-yl]amino]cycloheptyl]methanol has a molecular weight of 322.42 g/mol, XLogP of 2.93, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[1-(3,3,3-trifluoropropyl)piperidin-4-yl]amino]cycloheptyl]methanol is sourced from PubChem (CID 86785650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).