About 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methyl-2,3-dihydroquinoxaline
1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methyl-2,3-dihydroquinoxaline (PubChem CID 86785673) has the molecular formula C15H20N4
and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methyl-2,3-dihydroquinoxaline.
Molecular Properties
| Compound Name | 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methyl-2,3-dihydroquinoxaline |
| PubChem CID | 86785673 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methyl-2,3-dihydroquinoxaline |
| SMILES | Cc1n[nH]c(C)c1CN1CCN(C)c2ccccc21 |
| InChI | InChI=1S/C15H20N4/c1-11-13(12(2)17-16-11)10-19-9-8-18(3)14-6-4-5-7-15(14)19/h4-7H,8-10H2,1-3H3,(H,16,17) |
| InChIKey | BFXVUJXICNUEHC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methyl-2,3-dihydroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methyl-2,3-dihydroquinoxaline?
The IUPAC name of 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methyl-2,3-dihydroquinoxaline (CID 86785673) is 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methyl-2,3-dihydroquinoxaline.
What is the SMILES notation for 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methyl-2,3-dihydroquinoxaline?
The canonical SMILES for 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methyl-2,3-dihydroquinoxaline is Cc1n[nH]c(C)c1CN1CCN(C)c2ccccc21.
What is the InChIKey of 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methyl-2,3-dihydroquinoxaline?
The InChIKey is BFXVUJXICNUEHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4/c1-11-13(12(2)17-16-11)10-19-9-8-18(3)14-6-4-5-7-15(14)19/h4-7H,8-10H2,1-3H3,(H,16,17).
What are the key properties of 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methyl-2,3-dihydroquinoxaline?
1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methyl-2,3-dihydroquinoxaline has a molecular weight of 256.35 g/mol, XLogP of 2.48, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-methyl-2,3-dihydroquinoxaline is sourced from PubChem (CID 86785673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).