C11H9F3N2O — CID 86786151
2,4,5-trifluoro-N-[(5-methyl-1,3-oxazol-2-yl)methyl]aniline (PubChem CID 86786151) has the molecular formula C11H9F3N2O and a molecular weight of 242.20 g/mol. Its IUPAC name is 2,4,5-trifluoro-N-[(5-methyl-1,3-oxazol-2-yl)methyl]aniline.
| Compound Name | 2,4,5-trifluoro-N-[(5-methyl-1,3-oxazol-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 86786151 |
| Molecular Formula | C11H9F3N2O |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 2,4,5-trifluoro-N-[(5-methyl-1,3-oxazol-2-yl)methyl]aniline |
| SMILES | Cc1cnc(CNc2cc(F)c(F)cc2F)o1 |
| InChI | InChI=1S/C11H9F3N2O/c1-6-4-16-11(17-6)5-15-10-3-8(13)7(12)2-9(10)14/h2-4,15H,5H2,1H3 |
| InChIKey | HGZIKUQULSDRHX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|