About 1-[1-(1-cyclobutylpiperidin-3-yl)ethyl]-3-(2,2-difluoroethyl)urea
1-[1-(1-cyclobutylpiperidin-3-yl)ethyl]-3-(2,2-difluoroethyl)urea (PubChem CID 86786392) has the molecular formula C14H25F2N3O
and a molecular weight of 289.37 g/mol. Its IUPAC name is 1-[1-(1-cyclobutylpiperidin-3-yl)ethyl]-3-(2,2-difluoroethyl)urea.
Molecular Properties
| Compound Name | 1-[1-(1-cyclobutylpiperidin-3-yl)ethyl]-3-(2,2-difluoroethyl)urea |
| PubChem CID | 86786392 |
| Molecular Formula | C14H25F2N3O |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 1-[1-(1-cyclobutylpiperidin-3-yl)ethyl]-3-(2,2-difluoroethyl)urea |
| SMILES | CC(NC(=O)NCC(F)F)C1CCCN(C2CCC2)C1 |
| InChI | InChI=1S/C14H25F2N3O/c1-10(18-14(20)17-8-13(15)16)11-4-3-7-19(9-11)12-5-2-6-12/h10-13H,2-9H2,1H3,(H2,17,18,20) |
| InChIKey | AEKPTDFOBPIYPV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[1-(1-cyclobutylpiperidin-3-yl)ethyl]-3-(2,2-difluoroethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(1-cyclobutylpiperidin-3-yl)ethyl]-3-(2,2-difluoroethyl)urea?
The IUPAC name of 1-[1-(1-cyclobutylpiperidin-3-yl)ethyl]-3-(2,2-difluoroethyl)urea (CID 86786392) is 1-[1-(1-cyclobutylpiperidin-3-yl)ethyl]-3-(2,2-difluoroethyl)urea.
What is the SMILES notation for 1-[1-(1-cyclobutylpiperidin-3-yl)ethyl]-3-(2,2-difluoroethyl)urea?
The canonical SMILES for 1-[1-(1-cyclobutylpiperidin-3-yl)ethyl]-3-(2,2-difluoroethyl)urea is CC(NC(=O)NCC(F)F)C1CCCN(C2CCC2)C1.
What is the InChIKey of 1-[1-(1-cyclobutylpiperidin-3-yl)ethyl]-3-(2,2-difluoroethyl)urea?
The InChIKey is AEKPTDFOBPIYPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25F2N3O/c1-10(18-14(20)17-8-13(15)16)11-4-3-7-19(9-11)12-5-2-6-12/h10-13H,2-9H2,1H3,(H2,17,18,20).
What are the key properties of 1-[1-(1-cyclobutylpiperidin-3-yl)ethyl]-3-(2,2-difluoroethyl)urea?
1-[1-(1-cyclobutylpiperidin-3-yl)ethyl]-3-(2,2-difluoroethyl)urea has a molecular weight of 289.37 g/mol, XLogP of 2.20, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(1-cyclobutylpiperidin-3-yl)ethyl]-3-(2,2-difluoroethyl)urea is sourced from PubChem (CID 86786392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).