About methyl 2-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-2-(2,3-dichlorophenyl)acetate
methyl 2-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-2-(2,3-dichlorophenyl)acetate (PubChem CID 86786552) has the molecular formula C12H14Cl2N2O3
and a molecular weight of 305.16 g/mol. Its IUPAC name is methyl 2-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-2-(2,3-dichlorophenyl)acetate.
Molecular Properties
| Compound Name | methyl 2-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-2-(2,3-dichlorophenyl)acetate |
| PubChem CID | 86786552 |
| Molecular Formula | C12H14Cl2N2O3 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | methyl 2-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-2-(2,3-dichlorophenyl)acetate |
| SMILES | COC(=O)C(N[C@@H](C)C(N)=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H14Cl2N2O3/c1-6(11(15)17)16-10(12(18)19-2)7-4-3-5-8(13)9(7)14/h3-6,10,16H,1-2H3,(H2,15,17)/t6-,10?/m0/s1 |
| InChIKey | VWNYBPIIZBASQZ-UOQJWNSWSA-N |
| XLogP | 1.67 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-2-(2,3-dichlorophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-2-(2,3-dichlorophenyl)acetate?
The IUPAC name of methyl 2-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-2-(2,3-dichlorophenyl)acetate (CID 86786552) is methyl 2-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-2-(2,3-dichlorophenyl)acetate.
What is the SMILES notation for methyl 2-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-2-(2,3-dichlorophenyl)acetate?
The canonical SMILES for methyl 2-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-2-(2,3-dichlorophenyl)acetate is COC(=O)C(N[C@@H](C)C(N)=O)c1cccc(Cl)c1Cl.
What is the InChIKey of methyl 2-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-2-(2,3-dichlorophenyl)acetate?
The InChIKey is VWNYBPIIZBASQZ-UOQJWNSWSA-N. The full InChI is InChI=1S/C12H14Cl2N2O3/c1-6(11(15)17)16-10(12(18)19-2)7-4-3-5-8(13)9(7)14/h3-6,10,16H,1-2H3,(H2,15,17)/t6-,10?/m0/s1.
What are the key properties of methyl 2-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-2-(2,3-dichlorophenyl)acetate?
methyl 2-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-2-(2,3-dichlorophenyl)acetate has a molecular weight of 305.16 g/mol, XLogP of 1.67, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-2-(2,3-dichlorophenyl)acetate is sourced from PubChem (CID 86786552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).