C20H25N3O5 — CID 86787065
N-(1,3-benzodioxol-4-yl)-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 86787065) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-(1,3-benzodioxol-4-yl)-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-(1,3-benzodioxol-4-yl)-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 86787065 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-(1,3-benzodioxol-4-yl)-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CC1CC(C)(C)CC2(C1)NC(=O)N(CC(=O)Nc1cccc3c1OCO3)C2=O |
| InChI | InChI=1S/C20H25N3O5/c1-12-7-19(2,3)10-20(8-12)17(25)23(18(26)22-20)9-15(24)21-13-5-4-6-14-16(13)28-11-27-14/h4-6,12H,7-11H2,1-3H3,(H,21,24)(H,22,26) |
| InChIKey | RZKSWMUMHWQMTO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|