C13H21N3O — CID 86787486
[(1R,4S)-4-[1-(1,5-dimethylpyrazol-4-yl)ethylamino]cyclopent-2-en-1-yl]methanol (PubChem CID 86787486) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is [(1R,4S)-4-[1-(1,5-dimethylpyrazol-4-yl)ethylamino]cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,4S)-4-[1-(1,5-dimethylpyrazol-4-yl)ethylamino]cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 86787486 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | [(1R,4S)-4-[1-(1,5-dimethylpyrazol-4-yl)ethylamino]cyclopent-2-en-1-yl]methanol |
| SMILES | Cc1c(C(C)N[C@@H]2C=C[C@H](CO)C2)cnn1C |
| InChI | InChI=1S/C13H21N3O/c1-9(13-7-14-16(3)10(13)2)15-12-5-4-11(6-12)8-17/h4-5,7,9,11-12,15,17H,6,8H2,1-3H3/t9?,11-,12+/m0/s1 |
| InChIKey | OOZVBQWVYCGTEO-CLGJWYQZSA-N |
| XLogP | 1.32 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|