C17H23NO3 — CID 86787520
[(1R,4S)-4-[(7-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)amino]cyclopent-2-en-1-yl]methanol (PubChem CID 86787520) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is [(1R,4S)-4-[(7-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)amino]cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,4S)-4-[(7-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)amino]cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 86787520 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | [(1R,4S)-4-[(7-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)amino]cyclopent-2-en-1-yl]methanol |
| SMILES | COc1ccc2c(c1)C(N[C@@H]1C=C[C@H](CO)C1)CCCO2 |
| InChI | InChI=1S/C17H23NO3/c1-20-14-6-7-17-15(10-14)16(3-2-8-21-17)18-13-5-4-12(9-13)11-19/h4-7,10,12-13,16,18-19H,2-3,8-9,11H2,1H3/t12-,13+,16?/m0/s1 |
| InChIKey | ROVLMPKQJZBOON-FTLRAWMYSA-N |
| XLogP | 2.44 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|