C14H25N3S — CID 86787623
N-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]thian-3-amine (PubChem CID 86787623) has the molecular formula C14H25N3S and a molecular weight of 267.44 g/mol. Its IUPAC name is N-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]thian-3-amine.
| Compound Name | N-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]thian-3-amine |
|---|---|
| PubChem CID | 86787623 |
| Molecular Formula | C14H25N3S |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | N-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]thian-3-amine |
| SMILES | Cc1nn(C)c(C)c1CCCNC1CCCSC1 |
| InChI | InChI=1S/C14H25N3S/c1-11-14(12(2)17(3)16-11)7-4-8-15-13-6-5-9-18-10-13/h13,15H,4-10H2,1-3H3 |
| InChIKey | VPVZJVPHHKGMAY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|