About 1-(azepan-1-yl)-3-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)amino]butan-1-one
1-(azepan-1-yl)-3-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)amino]butan-1-one (PubChem CID 86787772) has the molecular formula C18H27N5O
and a molecular weight of 329.45 g/mol. Its IUPAC name is 1-(azepan-1-yl)-3-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)amino]butan-1-one.
Molecular Properties
| Compound Name | 1-(azepan-1-yl)-3-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)amino]butan-1-one |
| PubChem CID | 86787772 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | 1-(azepan-1-yl)-3-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)amino]butan-1-one |
| SMILES | Cc1nn(C)c2ncc(NC(C)CC(=O)N3CCCCCC3)cc12 |
| InChI | InChI=1S/C18H27N5O/c1-13(10-17(24)23-8-6-4-5-7-9-23)20-15-11-16-14(2)21-22(3)18(16)19-12-15/h11-13,20H,4-10H2,1-3H3 |
| InChIKey | MLBLEWACVTVANC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(azepan-1-yl)-3-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)amino]butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azepan-1-yl)-3-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)amino]butan-1-one?
The IUPAC name of 1-(azepan-1-yl)-3-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)amino]butan-1-one (CID 86787772) is 1-(azepan-1-yl)-3-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)amino]butan-1-one.
What is the SMILES notation for 1-(azepan-1-yl)-3-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)amino]butan-1-one?
The canonical SMILES for 1-(azepan-1-yl)-3-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)amino]butan-1-one is Cc1nn(C)c2ncc(NC(C)CC(=O)N3CCCCCC3)cc12.
What is the InChIKey of 1-(azepan-1-yl)-3-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)amino]butan-1-one?
The InChIKey is MLBLEWACVTVANC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N5O/c1-13(10-17(24)23-8-6-4-5-7-9-23)20-15-11-16-14(2)21-22(3)18(16)19-12-15/h11-13,20H,4-10H2,1-3H3.
What are the key properties of 1-(azepan-1-yl)-3-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)amino]butan-1-one?
1-(azepan-1-yl)-3-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)amino]butan-1-one has a molecular weight of 329.45 g/mol, XLogP of 2.87, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azepan-1-yl)-3-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)amino]butan-1-one is sourced from PubChem (CID 86787772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).