About 3-[2-[(7-bromo-1,5-naphthyridin-4-yl)amino]ethyl]-1,1-dimethylurea
3-[2-[(7-bromo-1,5-naphthyridin-4-yl)amino]ethyl]-1,1-dimethylurea (PubChem CID 86787923) has the molecular formula C13H16BrN5O
and a molecular weight of 338.21 g/mol. Its IUPAC name is 3-[2-[(7-bromo-1,5-naphthyridin-4-yl)amino]ethyl]-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-[2-[(7-bromo-1,5-naphthyridin-4-yl)amino]ethyl]-1,1-dimethylurea |
| PubChem CID | 86787923 |
| Molecular Formula | C13H16BrN5O |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 3-[2-[(7-bromo-1,5-naphthyridin-4-yl)amino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNc1ccnc2cc(Br)cnc12 |
| InChI | InChI=1S/C13H16BrN5O/c1-19(2)13(20)17-6-5-16-10-3-4-15-11-7-9(14)8-18-12(10)11/h3-4,7-8H,5-6H2,1-2H3,(H,15,16)(H,17,20) |
| InChIKey | SHHZANGFISEZDN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[(7-bromo-1,5-naphthyridin-4-yl)amino]ethyl]-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(7-bromo-1,5-naphthyridin-4-yl)amino]ethyl]-1,1-dimethylurea?
The IUPAC name of 3-[2-[(7-bromo-1,5-naphthyridin-4-yl)amino]ethyl]-1,1-dimethylurea (CID 86787923) is 3-[2-[(7-bromo-1,5-naphthyridin-4-yl)amino]ethyl]-1,1-dimethylurea.
What is the SMILES notation for 3-[2-[(7-bromo-1,5-naphthyridin-4-yl)amino]ethyl]-1,1-dimethylurea?
The canonical SMILES for 3-[2-[(7-bromo-1,5-naphthyridin-4-yl)amino]ethyl]-1,1-dimethylurea is CN(C)C(=O)NCCNc1ccnc2cc(Br)cnc12.
What is the InChIKey of 3-[2-[(7-bromo-1,5-naphthyridin-4-yl)amino]ethyl]-1,1-dimethylurea?
The InChIKey is SHHZANGFISEZDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrN5O/c1-19(2)13(20)17-6-5-16-10-3-4-15-11-7-9(14)8-18-12(10)11/h3-4,7-8H,5-6H2,1-2H3,(H,15,16)(H,17,20).
What are the key properties of 3-[2-[(7-bromo-1,5-naphthyridin-4-yl)amino]ethyl]-1,1-dimethylurea?
3-[2-[(7-bromo-1,5-naphthyridin-4-yl)amino]ethyl]-1,1-dimethylurea has a molecular weight of 338.21 g/mol, XLogP of 2.08, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(7-bromo-1,5-naphthyridin-4-yl)amino]ethyl]-1,1-dimethylurea is sourced from PubChem (CID 86787923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).