C17H26ClN3O2 — CID 86788739
N-[3-chloro-4-(morpholin-4-ylmethyl)phenyl]-2-[methyl(propan-2-yl)amino]acetamide (PubChem CID 86788739) has the molecular formula C17H26ClN3O2 and a molecular weight of 339.87 g/mol. Its IUPAC name is N-[3-chloro-4-(morpholin-4-ylmethyl)phenyl]-2-[methyl(propan-2-yl)amino]acetamide.
| Compound Name | N-[3-chloro-4-(morpholin-4-ylmethyl)phenyl]-2-[methyl(propan-2-yl)amino]acetamide |
|---|---|
| PubChem CID | 86788739 |
| Molecular Formula | C17H26ClN3O2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N-[3-chloro-4-(morpholin-4-ylmethyl)phenyl]-2-[methyl(propan-2-yl)amino]acetamide |
| SMILES | CC(C)N(C)CC(=O)Nc1ccc(CN2CCOCC2)c(Cl)c1 |
| InChI | InChI=1S/C17H26ClN3O2/c1-13(2)20(3)12-17(22)19-15-5-4-14(16(18)10-15)11-21-6-8-23-9-7-21/h4-5,10,13H,6-9,11-12H2,1-3H3,(H,19,22) |
| InChIKey | HGICJUMIANKVAL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |