C14H12ClF2N3O3 — CID 86788801
4-chloro-2,5-difluoro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]benzamide (PubChem CID 86788801) has the molecular formula C14H12ClF2N3O3 and a molecular weight of 343.72 g/mol. Its IUPAC name is 4-chloro-2,5-difluoro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]benzamide.
| Compound Name | 4-chloro-2,5-difluoro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]benzamide |
|---|---|
| PubChem CID | 86788801 |
| Molecular Formula | C14H12ClF2N3O3 |
| Molecular Weight | 343.72 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 4-chloro-2,5-difluoro-N-[4-(1,2,4-oxadiazol-3-yl)oxan-4-yl]benzamide |
| SMILES | O=C(NC1(c2ncon2)CCOCC1)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C14H12ClF2N3O3/c15-9-6-10(16)8(5-11(9)17)12(21)19-14(1-3-22-4-2-14)13-18-7-23-20-13/h5-7H,1-4H2,(H,19,21) |
| InChIKey | MQXSGSGFKKHGFR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.72 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|