C11H20N2O3 — CID 86789765
N-(4-amino-2-methyl-4-oxobutan-2-yl)-5-methyloxolane-2-carboxamide (PubChem CID 86789765) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is N-(4-amino-2-methyl-4-oxobutan-2-yl)-5-methyloxolane-2-carboxamide.
| Compound Name | N-(4-amino-2-methyl-4-oxobutan-2-yl)-5-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 86789765 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | N-(4-amino-2-methyl-4-oxobutan-2-yl)-5-methyloxolane-2-carboxamide |
| SMILES | CC1CCC(C(=O)NC(C)(C)CC(N)=O)O1 |
| InChI | InChI=1S/C11H20N2O3/c1-7-4-5-8(16-7)10(15)13-11(2,3)6-9(12)14/h7-8H,4-6H2,1-3H3,(H2,12,14)(H,13,15) |
| InChIKey | MBNIXTQHJASRBL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |