About 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-propan-2-ylpyrrolidin-2-one
3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-propan-2-ylpyrrolidin-2-one (PubChem CID 86790374) has the molecular formula C10H16N4OS
and a molecular weight of 240.33 g/mol. Its IUPAC name is 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-propan-2-ylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-propan-2-ylpyrrolidin-2-one |
| PubChem CID | 86790374 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-propan-2-ylpyrrolidin-2-one |
| SMILES | CC(C)N1CCC(Sc2ncnn2C)C1=O |
| InChI | InChI=1S/C10H16N4OS/c1-7(2)14-5-4-8(9(14)15)16-10-11-6-12-13(10)3/h6-8H,4-5H2,1-3H3 |
| InChIKey | GLVVOFHIOSHMED-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-propan-2-ylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-propan-2-ylpyrrolidin-2-one?
The IUPAC name of 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-propan-2-ylpyrrolidin-2-one (CID 86790374) is 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-propan-2-ylpyrrolidin-2-one.
What is the SMILES notation for 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-propan-2-ylpyrrolidin-2-one?
The canonical SMILES for 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-propan-2-ylpyrrolidin-2-one is CC(C)N1CCC(Sc2ncnn2C)C1=O.
What is the InChIKey of 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-propan-2-ylpyrrolidin-2-one?
The InChIKey is GLVVOFHIOSHMED-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4OS/c1-7(2)14-5-4-8(9(14)15)16-10-11-6-12-13(10)3/h6-8H,4-5H2,1-3H3.
What are the key properties of 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-propan-2-ylpyrrolidin-2-one?
3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-propan-2-ylpyrrolidin-2-one has a molecular weight of 240.33 g/mol, XLogP of 0.92, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-propan-2-ylpyrrolidin-2-one is sourced from PubChem (CID 86790374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).