C15H22N4O3 — CID 86790471
2-amino-N-methyl-N-[(4-methylcyclohexyl)methyl]-5-nitropyridine-3-carboxamide (PubChem CID 86790471) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-amino-N-methyl-N-[(4-methylcyclohexyl)methyl]-5-nitropyridine-3-carboxamide.
| Compound Name | 2-amino-N-methyl-N-[(4-methylcyclohexyl)methyl]-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 86790471 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2-amino-N-methyl-N-[(4-methylcyclohexyl)methyl]-5-nitropyridine-3-carboxamide |
| SMILES | CC1CCC(CN(C)C(=O)c2cc([N+](=O)[O-])cnc2N)CC1 |
| InChI | InChI=1S/C15H22N4O3/c1-10-3-5-11(6-4-10)9-18(2)15(20)13-7-12(19(21)22)8-17-14(13)16/h7-8,10-11H,3-6,9H2,1-2H3,(H2,16,17) |
| InChIKey | HIPALNHQXNSCCZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|