C15H19N3O3S — CID 86790643
4-amino-N-[4-(2-oxo-1-pyridinyl)butyl]benzenesulfonamide (PubChem CID 86790643) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 4-amino-N-[4-(2-oxo-1-pyridinyl)butyl]benzenesulfonamide.
| Compound Name | 4-amino-N-[4-(2-oxo-1-pyridinyl)butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 86790643 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 4-amino-N-[4-(2-oxo-1-pyridinyl)butyl]benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)NCCCCn2ccccc2=O)cc1 |
| InChI | InChI=1S/C15H19N3O3S/c16-13-6-8-14(9-7-13)22(20,21)17-10-2-4-12-18-11-3-1-5-15(18)19/h1,3,5-9,11,17H,2,4,10,12,16H2 |
| InChIKey | XSSJWCGKTHVONA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|