C11H16N4O — CID 86790800
N-(2,5-dimethyl-1,2,4-triazol-3-yl)hept-6-ynamide (PubChem CID 86790800) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is N-(2,5-dimethyl-1,2,4-triazol-3-yl)hept-6-ynamide.
| Compound Name | N-(2,5-dimethyl-1,2,4-triazol-3-yl)hept-6-ynamide |
|---|---|
| PubChem CID | 86790800 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | N-(2,5-dimethyl-1,2,4-triazol-3-yl)hept-6-ynamide |
| SMILES | C#CCCCCC(=O)Nc1nc(C)nn1C |
| InChI | InChI=1S/C11H16N4O/c1-4-5-6-7-8-10(16)13-11-12-9(2)14-15(11)3/h1H,5-8H2,2-3H3,(H,12,13,14,16) |
| InChIKey | AGKKMEGUMBARKK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|