About 4-methoxy-2,2-dimethyl-1-[4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]butan-1-one
4-methoxy-2,2-dimethyl-1-[4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]butan-1-one (PubChem CID 86791067) has the molecular formula C16H24F3N3O2
and a molecular weight of 347.38 g/mol. Its IUPAC name is 4-methoxy-2,2-dimethyl-1-[4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]butan-1-one.
Molecular Properties
| Compound Name | 4-methoxy-2,2-dimethyl-1-[4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]butan-1-one |
| PubChem CID | 86791067 |
| Molecular Formula | C16H24F3N3O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 4-methoxy-2,2-dimethyl-1-[4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]butan-1-one |
| SMILES | COCCC(C)(C)C(=O)N1CCC(c2ncc(C(F)(F)F)[nH]2)CC1 |
| InChI | InChI=1S/C16H24F3N3O2/c1-15(2,6-9-24-3)14(23)22-7-4-11(5-8-22)13-20-10-12(21-13)16(17,18)19/h10-11H,4-9H2,1-3H3,(H,20,21) |
| InChIKey | IDSGSQOQKGXVDB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxy-2,2-dimethyl-1-[4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2,2-dimethyl-1-[4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]butan-1-one?
The IUPAC name of 4-methoxy-2,2-dimethyl-1-[4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]butan-1-one (CID 86791067) is 4-methoxy-2,2-dimethyl-1-[4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]butan-1-one.
What is the SMILES notation for 4-methoxy-2,2-dimethyl-1-[4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]butan-1-one?
The canonical SMILES for 4-methoxy-2,2-dimethyl-1-[4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]butan-1-one is COCCC(C)(C)C(=O)N1CCC(c2ncc(C(F)(F)F)[nH]2)CC1.
What is the InChIKey of 4-methoxy-2,2-dimethyl-1-[4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]butan-1-one?
The InChIKey is IDSGSQOQKGXVDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24F3N3O2/c1-15(2,6-9-24-3)14(23)22-7-4-11(5-8-22)13-20-10-12(21-13)16(17,18)19/h10-11H,4-9H2,1-3H3,(H,20,21).
What are the key properties of 4-methoxy-2,2-dimethyl-1-[4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]butan-1-one?
4-methoxy-2,2-dimethyl-1-[4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]butan-1-one has a molecular weight of 347.38 g/mol, XLogP of 3.20, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2,2-dimethyl-1-[4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]butan-1-one is sourced from PubChem (CID 86791067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).