About N-tert-butyl-2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]propanamide
N-tert-butyl-2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]propanamide (PubChem CID 86791911) has the molecular formula C12H20F2N4O
and a molecular weight of 274.32 g/mol. Its IUPAC name is N-tert-butyl-2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]propanamide.
Molecular Properties
| Compound Name | N-tert-butyl-2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]propanamide |
| PubChem CID | 86791911 |
| Molecular Formula | C12H20F2N4O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | N-tert-butyl-2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]propanamide |
| SMILES | CC(Nc1cnn(CC(F)F)c1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C12H20F2N4O/c1-8(11(19)17-12(2,3)4)16-9-5-15-18(6-9)7-10(13)14/h5-6,8,10,16H,7H2,1-4H3,(H,17,19) |
| InChIKey | BXNRVGQCJDSXCY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-tert-butyl-2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]propanamide?
The IUPAC name of N-tert-butyl-2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]propanamide (CID 86791911) is N-tert-butyl-2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]propanamide.
What is the SMILES notation for N-tert-butyl-2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]propanamide?
The canonical SMILES for N-tert-butyl-2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]propanamide is CC(Nc1cnn(CC(F)F)c1)C(=O)NC(C)(C)C.
What is the InChIKey of N-tert-butyl-2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]propanamide?
The InChIKey is BXNRVGQCJDSXCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F2N4O/c1-8(11(19)17-12(2,3)4)16-9-5-15-18(6-9)7-10(13)14/h5-6,8,10,16H,7H2,1-4H3,(H,17,19).
What are the key properties of N-tert-butyl-2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]propanamide?
N-tert-butyl-2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]propanamide has a molecular weight of 274.32 g/mol, XLogP of 1.86, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]amino]propanamide is sourced from PubChem (CID 86791911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).