About tert-butyl 2-[5-[1-(4-methoxyphenoxy)ethyl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carboxylate
tert-butyl 2-[5-[1-(4-methoxyphenoxy)ethyl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carboxylate (PubChem CID 86792440) has the molecular formula C20H27N3O5
and a molecular weight of 389.45 g/mol. Its IUPAC name is tert-butyl 2-[5-[1-(4-methoxyphenoxy)ethyl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-[5-[1-(4-methoxyphenoxy)ethyl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carboxylate |
| PubChem CID | 86792440 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | tert-butyl 2-[5-[1-(4-methoxyphenoxy)ethyl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carboxylate |
| SMILES | COc1ccc(OC(C)c2nc(C3CCCN3C(=O)OC(C)(C)C)no2)cc1 |
| InChI | InChI=1S/C20H27N3O5/c1-13(26-15-10-8-14(25-5)9-11-15)18-21-17(22-28-18)16-7-6-12-23(16)19(24)27-20(2,3)4/h8-11,13,16H,6-7,12H2,1-5H3 |
| InChIKey | FDKDPIBFXLJSBB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 86.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl 2-[5-[1-(4-methoxyphenoxy)ethyl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[5-[1-(4-methoxyphenoxy)ethyl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl 2-[5-[1-(4-methoxyphenoxy)ethyl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carboxylate (CID 86792440) is tert-butyl 2-[5-[1-(4-methoxyphenoxy)ethyl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl 2-[5-[1-(4-methoxyphenoxy)ethyl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl 2-[5-[1-(4-methoxyphenoxy)ethyl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carboxylate is COc1ccc(OC(C)c2nc(C3CCCN3C(=O)OC(C)(C)C)no2)cc1.
What is the InChIKey of tert-butyl 2-[5-[1-(4-methoxyphenoxy)ethyl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carboxylate?
The InChIKey is FDKDPIBFXLJSBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N3O5/c1-13(26-15-10-8-14(25-5)9-11-15)18-21-17(22-28-18)16-7-6-12-23(16)19(24)27-20(2,3)4/h8-11,13,16H,6-7,12H2,1-5H3.
What are the key properties of tert-butyl 2-[5-[1-(4-methoxyphenoxy)ethyl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carboxylate?
tert-butyl 2-[5-[1-(4-methoxyphenoxy)ethyl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carboxylate has a molecular weight of 389.45 g/mol, XLogP of 4.29, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[5-[1-(4-methoxyphenoxy)ethyl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carboxylate is sourced from PubChem (CID 86792440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).