C15H19N3O2S2 — CID 86792707
4-[[5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl]-1,4-thiazinane 1-oxide (PubChem CID 86792707) has the molecular formula C15H19N3O2S2 and a molecular weight of 337.47 g/mol. Its IUPAC name is 4-[[5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl]-1,4-thiazinane 1-oxide.
| Compound Name | 4-[[5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl]-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 86792707 |
| Molecular Formula | C15H19N3O2S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 4-[[5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl]-1,4-thiazinane 1-oxide |
| SMILES | O=S1CCN(Cc2nnc(-c3cc4c(s3)CCCC4)o2)CC1 |
| InChI | InChI=1S/C15H19N3O2S2/c19-22-7-5-18(6-8-22)10-14-16-17-15(20-14)13-9-11-3-1-2-4-12(11)21-13/h9H,1-8,10H2 |
| InChIKey | DDFWWLMFVKFFCT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |