About 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(6-methyl-2-pyridinyl)urea
1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(6-methyl-2-pyridinyl)urea (PubChem CID 86793305) has the molecular formula C13H17N3O2
and a molecular weight of 247.30 g/mol. Its IUPAC name is 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(6-methyl-2-pyridinyl)urea.
Molecular Properties
| Compound Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(6-methyl-2-pyridinyl)urea |
| PubChem CID | 86793305 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(6-methyl-2-pyridinyl)urea |
| SMILES | Cc1cccc(NC(=O)N[C@@H]2C=C[C@H](CO)C2)n1 |
| InChI | InChI=1S/C13H17N3O2/c1-9-3-2-4-12(14-9)16-13(18)15-11-6-5-10(7-11)8-17/h2-6,10-11,17H,7-8H2,1H3,(H2,14,15,16,18)/t10-,11+/m0/s1 |
| InChIKey | PHWJGNSYQXKAIY-WDEREUQCSA-N |
| XLogP | 1.45 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(6-methyl-2-pyridinyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(6-methyl-2-pyridinyl)urea?
The IUPAC name of 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(6-methyl-2-pyridinyl)urea (CID 86793305) is 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(6-methyl-2-pyridinyl)urea.
What is the SMILES notation for 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(6-methyl-2-pyridinyl)urea?
The canonical SMILES for 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(6-methyl-2-pyridinyl)urea is Cc1cccc(NC(=O)N[C@@H]2C=C[C@H](CO)C2)n1.
What is the InChIKey of 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(6-methyl-2-pyridinyl)urea?
The InChIKey is PHWJGNSYQXKAIY-WDEREUQCSA-N. The full InChI is InChI=1S/C13H17N3O2/c1-9-3-2-4-12(14-9)16-13(18)15-11-6-5-10(7-11)8-17/h2-6,10-11,17H,7-8H2,1H3,(H2,14,15,16,18)/t10-,11+/m0/s1.
What are the key properties of 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(6-methyl-2-pyridinyl)urea?
1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(6-methyl-2-pyridinyl)urea has a molecular weight of 247.30 g/mol, XLogP of 1.45, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(6-methyl-2-pyridinyl)urea is sourced from PubChem (CID 86793305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).