C17H25N3O2 — CID 86793417
N-(4,6-dimethyl-2-pyridinyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxamide (PubChem CID 86793417) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is N-(4,6-dimethyl-2-pyridinyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxamide.
| Compound Name | N-(4,6-dimethyl-2-pyridinyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 86793417 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N-(4,6-dimethyl-2-pyridinyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carboxamide |
| SMILES | Cc1cc(C)nc(NC(=O)N2CCC3(O)CCCCC3C2)c1 |
| InChI | InChI=1S/C17H25N3O2/c1-12-9-13(2)18-15(10-12)19-16(21)20-8-7-17(22)6-4-3-5-14(17)11-20/h9-10,14,22H,3-8,11H2,1-2H3,(H,18,19,21) |
| InChIKey | XDTONZQBWRRHPD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |