C14H19N5O2 — CID 86793478
1-(3-methoxy-6-methyl-2-pyridinyl)-3-[2-(4-methylpyrazol-1-yl)ethyl]urea (PubChem CID 86793478) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 1-(3-methoxy-6-methyl-2-pyridinyl)-3-[2-(4-methylpyrazol-1-yl)ethyl]urea.
| Compound Name | 1-(3-methoxy-6-methyl-2-pyridinyl)-3-[2-(4-methylpyrazol-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 86793478 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 1-(3-methoxy-6-methyl-2-pyridinyl)-3-[2-(4-methylpyrazol-1-yl)ethyl]urea |
| SMILES | COc1ccc(C)nc1NC(=O)NCCn1cc(C)cn1 |
| InChI | InChI=1S/C14H19N5O2/c1-10-8-16-19(9-10)7-6-15-14(20)18-13-12(21-3)5-4-11(2)17-13/h4-5,8-9H,6-7H2,1-3H3,(H2,15,17,18,20) |
| InChIKey | WNNKWCWXCSOICX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |