C18H20N2O2S — CID 8679383
1-[(2-hydroxyphenyl)methyl]-1-(2-methoxyphenyl)-3-prop-2-enylthiourea (PubChem CID 8679383) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is 1-[(2-hydroxyphenyl)methyl]-1-(2-methoxyphenyl)-3-prop-2-enylthiourea.
| Compound Name | 1-[(2-hydroxyphenyl)methyl]-1-(2-methoxyphenyl)-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 8679383 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 1-[(2-hydroxyphenyl)methyl]-1-(2-methoxyphenyl)-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)N(Cc1ccccc1O)c1ccccc1OC |
| InChI | InChI=1S/C18H20N2O2S/c1-3-12-19-18(23)20(13-14-8-4-6-10-16(14)21)15-9-5-7-11-17(15)22-2/h3-11,21H,1,12-13H2,2H3,(H,19,23) |
| InChIKey | DHFRTSPIARCBQC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|