About (3R)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)butan-1-ol
(3R)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)butan-1-ol (PubChem CID 86793868) has the molecular formula C12H23NO3
and a molecular weight of 229.32 g/mol. Its IUPAC name is (3R)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)butan-1-ol.
Molecular Properties
| Compound Name | (3R)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)butan-1-ol |
| PubChem CID | 86793868 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | (3R)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)butan-1-ol |
| SMILES | C[C@H](CCO)NC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C12H23NO3/c1-10(4-7-14)13-11-2-5-12(6-3-11)15-8-9-16-12/h10-11,13-14H,2-9H2,1H3/t10-/m1/s1 |
| InChIKey | MOHDPHRMUYLPRR-SNVBAGLBSA-N |
| XLogP | 1.03 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)butan-1-ol?
The IUPAC name of (3R)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)butan-1-ol (CID 86793868) is (3R)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)butan-1-ol.
What is the SMILES notation for (3R)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)butan-1-ol?
The canonical SMILES for (3R)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)butan-1-ol is C[C@H](CCO)NC1CCC2(CC1)OCCO2.
What is the InChIKey of (3R)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)butan-1-ol?
The InChIKey is MOHDPHRMUYLPRR-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H23NO3/c1-10(4-7-14)13-11-2-5-12(6-3-11)15-8-9-16-12/h10-11,13-14H,2-9H2,1H3/t10-/m1/s1.
What are the key properties of (3R)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)butan-1-ol?
(3R)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)butan-1-ol has a molecular weight of 229.32 g/mol, XLogP of 1.03, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(1,4-dioxaspiro[4.5]decan-8-ylamino)butan-1-ol is sourced from PubChem (CID 86793868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).