C10H18F3N3O3S — CID 86793937
1-[2-(methanesulfonamido)cyclohexyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 86793937) has the molecular formula C10H18F3N3O3S and a molecular weight of 317.33 g/mol. Its IUPAC name is 1-[2-(methanesulfonamido)cyclohexyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[2-(methanesulfonamido)cyclohexyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 86793937 |
| Molecular Formula | C10H18F3N3O3S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 1-[2-(methanesulfonamido)cyclohexyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CS(=O)(=O)NC1CCCCC1NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H18F3N3O3S/c1-20(18,19)16-8-5-3-2-4-7(8)15-9(17)14-6-10(11,12)13/h7-8,16H,2-6H2,1H3,(H2,14,15,17) |
| InChIKey | VWTDZPDZRKGZPX-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |