C17H26N4O3 — CID 86794429
3-(diethylamino)-N-(2,4-dimethyl-5-nitrophenyl)pyrrolidine-1-carboxamide (PubChem CID 86794429) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 3-(diethylamino)-N-(2,4-dimethyl-5-nitrophenyl)pyrrolidine-1-carboxamide.
| Compound Name | 3-(diethylamino)-N-(2,4-dimethyl-5-nitrophenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 86794429 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 3-(diethylamino)-N-(2,4-dimethyl-5-nitrophenyl)pyrrolidine-1-carboxamide |
| SMILES | CCN(CC)C1CCN(C(=O)Nc2cc([N+](=O)[O-])c(C)cc2C)C1 |
| InChI | InChI=1S/C17H26N4O3/c1-5-19(6-2)14-7-8-20(11-14)17(22)18-15-10-16(21(23)24)13(4)9-12(15)3/h9-10,14H,5-8,11H2,1-4H3,(H,18,22) |
| InChIKey | IIOZEPUHXJEXCT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|