C8H8F2N2O3 — CID 86794482
1-(2,2-difluoroethyl)-3-prop-2-enylimidazolidine-2,4,5-trione (PubChem CID 86794482) has the molecular formula C8H8F2N2O3 and a molecular weight of 218.16 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-prop-2-enylimidazolidine-2,4,5-trione.
| Compound Name | 1-(2,2-difluoroethyl)-3-prop-2-enylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 86794482 |
| Molecular Formula | C8H8F2N2O3 |
| Molecular Weight | 218.16 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-prop-2-enylimidazolidine-2,4,5-trione |
| SMILES | C=CCN1C(=O)C(=O)N(CC(F)F)C1=O |
| InChI | InChI=1S/C8H8F2N2O3/c1-2-3-11-6(13)7(14)12(8(11)15)4-5(9)10/h2,5H,1,3-4H2 |
| InChIKey | ZNBYKTCPBXDXSD-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.16 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|