About 5-[4-hydroxy-4-(trifluoromethyl)piperidin-1-yl]-4,4-dimethylpentanenitrile
5-[4-hydroxy-4-(trifluoromethyl)piperidin-1-yl]-4,4-dimethylpentanenitrile (PubChem CID 86796033) has the molecular formula C13H21F3N2O
and a molecular weight of 278.32 g/mol. Its IUPAC name is 5-[4-hydroxy-4-(trifluoromethyl)piperidin-1-yl]-4,4-dimethylpentanenitrile.
Molecular Properties
| Compound Name | 5-[4-hydroxy-4-(trifluoromethyl)piperidin-1-yl]-4,4-dimethylpentanenitrile |
| PubChem CID | 86796033 |
| Molecular Formula | C13H21F3N2O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 5-[4-hydroxy-4-(trifluoromethyl)piperidin-1-yl]-4,4-dimethylpentanenitrile |
| SMILES | CC(C)(CCC#N)CN1CCC(O)(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H21F3N2O/c1-11(2,4-3-7-17)10-18-8-5-12(19,6-9-18)13(14,15)16/h19H,3-6,8-10H2,1-2H3 |
| InChIKey | KDYSDRUWDJWPAL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[4-hydroxy-4-(trifluoromethyl)piperidin-1-yl]-4,4-dimethylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-hydroxy-4-(trifluoromethyl)piperidin-1-yl]-4,4-dimethylpentanenitrile?
The IUPAC name of 5-[4-hydroxy-4-(trifluoromethyl)piperidin-1-yl]-4,4-dimethylpentanenitrile (CID 86796033) is 5-[4-hydroxy-4-(trifluoromethyl)piperidin-1-yl]-4,4-dimethylpentanenitrile.
What is the SMILES notation for 5-[4-hydroxy-4-(trifluoromethyl)piperidin-1-yl]-4,4-dimethylpentanenitrile?
The canonical SMILES for 5-[4-hydroxy-4-(trifluoromethyl)piperidin-1-yl]-4,4-dimethylpentanenitrile is CC(C)(CCC#N)CN1CCC(O)(C(F)(F)F)CC1.
What is the InChIKey of 5-[4-hydroxy-4-(trifluoromethyl)piperidin-1-yl]-4,4-dimethylpentanenitrile?
The InChIKey is KDYSDRUWDJWPAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21F3N2O/c1-11(2,4-3-7-17)10-18-8-5-12(19,6-9-18)13(14,15)16/h19H,3-6,8-10H2,1-2H3.
What are the key properties of 5-[4-hydroxy-4-(trifluoromethyl)piperidin-1-yl]-4,4-dimethylpentanenitrile?
5-[4-hydroxy-4-(trifluoromethyl)piperidin-1-yl]-4,4-dimethylpentanenitrile has a molecular weight of 278.32 g/mol, XLogP of 2.71, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-hydroxy-4-(trifluoromethyl)piperidin-1-yl]-4,4-dimethylpentanenitrile is sourced from PubChem (CID 86796033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).