About [2-(ethylamino)-1,3-thiazol-5-yl]-(1,2-oxazolidin-2-yl)methanone
[2-(ethylamino)-1,3-thiazol-5-yl]-(1,2-oxazolidin-2-yl)methanone (PubChem CID 86797132) has the molecular formula C9H13N3O2S
and a molecular weight of 227.29 g/mol. Its IUPAC name is [2-(ethylamino)-1,3-thiazol-5-yl]-(1,2-oxazolidin-2-yl)methanone.
Molecular Properties
| Compound Name | [2-(ethylamino)-1,3-thiazol-5-yl]-(1,2-oxazolidin-2-yl)methanone |
| PubChem CID | 86797132 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | [2-(ethylamino)-1,3-thiazol-5-yl]-(1,2-oxazolidin-2-yl)methanone |
| SMILES | CCNc1ncc(C(=O)N2CCCO2)s1 |
| InChI | InChI=1S/C9H13N3O2S/c1-2-10-9-11-6-7(15-9)8(13)12-4-3-5-14-12/h6H,2-5H2,1H3,(H,10,11) |
| InChIKey | XMKUXPLKIBWPPF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(ethylamino)-1,3-thiazol-5-yl]-(1,2-oxazolidin-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(ethylamino)-1,3-thiazol-5-yl]-(1,2-oxazolidin-2-yl)methanone?
The IUPAC name of [2-(ethylamino)-1,3-thiazol-5-yl]-(1,2-oxazolidin-2-yl)methanone (CID 86797132) is [2-(ethylamino)-1,3-thiazol-5-yl]-(1,2-oxazolidin-2-yl)methanone.
What is the SMILES notation for [2-(ethylamino)-1,3-thiazol-5-yl]-(1,2-oxazolidin-2-yl)methanone?
The canonical SMILES for [2-(ethylamino)-1,3-thiazol-5-yl]-(1,2-oxazolidin-2-yl)methanone is CCNc1ncc(C(=O)N2CCCO2)s1.
What is the InChIKey of [2-(ethylamino)-1,3-thiazol-5-yl]-(1,2-oxazolidin-2-yl)methanone?
The InChIKey is XMKUXPLKIBWPPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2S/c1-2-10-9-11-6-7(15-9)8(13)12-4-3-5-14-12/h6H,2-5H2,1H3,(H,10,11).
What are the key properties of [2-(ethylamino)-1,3-thiazol-5-yl]-(1,2-oxazolidin-2-yl)methanone?
[2-(ethylamino)-1,3-thiazol-5-yl]-(1,2-oxazolidin-2-yl)methanone has a molecular weight of 227.29 g/mol, XLogP of 1.35, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(ethylamino)-1,3-thiazol-5-yl]-(1,2-oxazolidin-2-yl)methanone is sourced from PubChem (CID 86797132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).