About 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[2-(trifluoromethyl)cyclohexyl]butanamide
3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[2-(trifluoromethyl)cyclohexyl]butanamide (PubChem CID 86797668) has the molecular formula C16H24F3N3O
and a molecular weight of 331.38 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[2-(trifluoromethyl)cyclohexyl]butanamide.
Molecular Properties
| Compound Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[2-(trifluoromethyl)cyclohexyl]butanamide |
| PubChem CID | 86797668 |
| Molecular Formula | C16H24F3N3O |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[2-(trifluoromethyl)cyclohexyl]butanamide |
| SMILES | Cc1n[nH]c(C)c1C(C)CC(=O)NC1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C16H24F3N3O/c1-9(15-10(2)21-22-11(15)3)8-14(23)20-13-7-5-4-6-12(13)16(17,18)19/h9,12-13H,4-8H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | AKJBOWOXHRIRKO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[2-(trifluoromethyl)cyclohexyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[2-(trifluoromethyl)cyclohexyl]butanamide?
The IUPAC name of 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[2-(trifluoromethyl)cyclohexyl]butanamide (CID 86797668) is 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[2-(trifluoromethyl)cyclohexyl]butanamide.
What is the SMILES notation for 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[2-(trifluoromethyl)cyclohexyl]butanamide?
The canonical SMILES for 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[2-(trifluoromethyl)cyclohexyl]butanamide is Cc1n[nH]c(C)c1C(C)CC(=O)NC1CCCCC1C(F)(F)F.
What is the InChIKey of 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[2-(trifluoromethyl)cyclohexyl]butanamide?
The InChIKey is AKJBOWOXHRIRKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24F3N3O/c1-9(15-10(2)21-22-11(15)3)8-14(23)20-13-7-5-4-6-12(13)16(17,18)19/h9,12-13H,4-8H2,1-3H3,(H,20,23)(H,21,22).
What are the key properties of 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[2-(trifluoromethyl)cyclohexyl]butanamide?
3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[2-(trifluoromethyl)cyclohexyl]butanamide has a molecular weight of 331.38 g/mol, XLogP of 3.76, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[2-(trifluoromethyl)cyclohexyl]butanamide is sourced from PubChem (CID 86797668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).