C13H20N4O2 — CID 86797798
6-(6-ethoxypyrimidin-4-yl)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 86797798) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 6-(6-ethoxypyrimidin-4-yl)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | 6-(6-ethoxypyrimidin-4-yl)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 86797798 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 6-(6-ethoxypyrimidin-4-yl)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | CCOc1cc(N2CC3OCCN(C)C3C2)ncn1 |
| InChI | InChI=1S/C13H20N4O2/c1-3-18-13-6-12(14-9-15-13)17-7-10-11(8-17)19-5-4-16(10)2/h6,9-11H,3-5,7-8H2,1-2H3 |
| InChIKey | JVWORGLHWKDCDP-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |