About 3-(3,5-dimethyl-1H-pyrazol-4-yl)-1-[4-(2-methoxyethyl)piperazin-1-yl]butan-1-one
3-(3,5-dimethyl-1H-pyrazol-4-yl)-1-[4-(2-methoxyethyl)piperazin-1-yl]butan-1-one (PubChem CID 86798223) has the molecular formula C16H28N4O2
and a molecular weight of 308.43 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1H-pyrazol-4-yl)-1-[4-(2-methoxyethyl)piperazin-1-yl]butan-1-one.
Molecular Properties
| Compound Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)-1-[4-(2-methoxyethyl)piperazin-1-yl]butan-1-one |
| PubChem CID | 86798223 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)-1-[4-(2-methoxyethyl)piperazin-1-yl]butan-1-one |
| SMILES | COCCN1CCN(C(=O)CC(C)c2c(C)n[nH]c2C)CC1 |
| InChI | InChI=1S/C16H28N4O2/c1-12(16-13(2)17-18-14(16)3)11-15(21)20-7-5-19(6-8-20)9-10-22-4/h12H,5-11H2,1-4H3,(H,17,18) |
| InChIKey | ZEZSQYQQBQTURH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3,5-dimethyl-1H-pyrazol-4-yl)-1-[4-(2-methoxyethyl)piperazin-1-yl]butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethyl-1H-pyrazol-4-yl)-1-[4-(2-methoxyethyl)piperazin-1-yl]butan-1-one?
The IUPAC name of 3-(3,5-dimethyl-1H-pyrazol-4-yl)-1-[4-(2-methoxyethyl)piperazin-1-yl]butan-1-one (CID 86798223) is 3-(3,5-dimethyl-1H-pyrazol-4-yl)-1-[4-(2-methoxyethyl)piperazin-1-yl]butan-1-one.
What is the SMILES notation for 3-(3,5-dimethyl-1H-pyrazol-4-yl)-1-[4-(2-methoxyethyl)piperazin-1-yl]butan-1-one?
The canonical SMILES for 3-(3,5-dimethyl-1H-pyrazol-4-yl)-1-[4-(2-methoxyethyl)piperazin-1-yl]butan-1-one is COCCN1CCN(C(=O)CC(C)c2c(C)n[nH]c2C)CC1.
What is the InChIKey of 3-(3,5-dimethyl-1H-pyrazol-4-yl)-1-[4-(2-methoxyethyl)piperazin-1-yl]butan-1-one?
The InChIKey is ZEZSQYQQBQTURH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N4O2/c1-12(16-13(2)17-18-14(16)3)11-15(21)20-7-5-19(6-8-20)9-10-22-4/h12H,5-11H2,1-4H3,(H,17,18).
What are the key properties of 3-(3,5-dimethyl-1H-pyrazol-4-yl)-1-[4-(2-methoxyethyl)piperazin-1-yl]butan-1-one?
3-(3,5-dimethyl-1H-pyrazol-4-yl)-1-[4-(2-methoxyethyl)piperazin-1-yl]butan-1-one has a molecular weight of 308.43 g/mol, XLogP of 1.31, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethyl-1H-pyrazol-4-yl)-1-[4-(2-methoxyethyl)piperazin-1-yl]butan-1-one is sourced from PubChem (CID 86798223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).