About 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 6-pyrrolidin-1-ylpyridine-3-carboxylate
2-(1,3,5-trimethylpyrazol-4-yl)ethyl 6-pyrrolidin-1-ylpyridine-3-carboxylate (PubChem CID 86798883) has the molecular formula C18H24N4O2
and a molecular weight of 328.42 g/mol. Its IUPAC name is 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 6-pyrrolidin-1-ylpyridine-3-carboxylate.
Molecular Properties
| Compound Name | 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 6-pyrrolidin-1-ylpyridine-3-carboxylate |
| PubChem CID | 86798883 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 6-pyrrolidin-1-ylpyridine-3-carboxylate |
| SMILES | Cc1nn(C)c(C)c1CCOC(=O)c1ccc(N2CCCC2)nc1 |
| InChI | InChI=1S/C18H24N4O2/c1-13-16(14(2)21(3)20-13)8-11-24-18(23)15-6-7-17(19-12-15)22-9-4-5-10-22/h6-7,12H,4-5,8-11H2,1-3H3 |
| InChIKey | AAXXWIMISVCWNM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 6-pyrrolidin-1-ylpyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 6-pyrrolidin-1-ylpyridine-3-carboxylate?
The IUPAC name of 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 6-pyrrolidin-1-ylpyridine-3-carboxylate (CID 86798883) is 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 6-pyrrolidin-1-ylpyridine-3-carboxylate.
What is the SMILES notation for 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 6-pyrrolidin-1-ylpyridine-3-carboxylate?
The canonical SMILES for 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 6-pyrrolidin-1-ylpyridine-3-carboxylate is Cc1nn(C)c(C)c1CCOC(=O)c1ccc(N2CCCC2)nc1.
What is the InChIKey of 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 6-pyrrolidin-1-ylpyridine-3-carboxylate?
The InChIKey is AAXXWIMISVCWNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4O2/c1-13-16(14(2)21(3)20-13)8-11-24-18(23)15-6-7-17(19-12-15)22-9-4-5-10-22/h6-7,12H,4-5,8-11H2,1-3H3.
What are the key properties of 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 6-pyrrolidin-1-ylpyridine-3-carboxylate?
2-(1,3,5-trimethylpyrazol-4-yl)ethyl 6-pyrrolidin-1-ylpyridine-3-carboxylate has a molecular weight of 328.42 g/mol, XLogP of 2.43, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 6-pyrrolidin-1-ylpyridine-3-carboxylate is sourced from PubChem (CID 86798883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).