About 3-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one
3-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one (PubChem CID 86799185) has the molecular formula C15H11F2N3OS
and a molecular weight of 319.34 g/mol. Its IUPAC name is 3-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one.
Molecular Properties
| Compound Name | 3-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one |
| PubChem CID | 86799185 |
| Molecular Formula | C15H11F2N3OS |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 3-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one |
| SMILES | Cc1cc(=O)n(Cc2nc(-c3c(F)cccc3F)cs2)cn1 |
| InChI | InChI=1S/C15H11F2N3OS/c1-9-5-14(21)20(8-18-9)6-13-19-12(7-22-13)15-10(16)3-2-4-11(15)17/h2-5,7-8H,6H2,1H3 |
| InChIKey | HIMYLCNWVHDCGR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one?
The IUPAC name of 3-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one (CID 86799185) is 3-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one.
What is the SMILES notation for 3-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one?
The canonical SMILES for 3-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one is Cc1cc(=O)n(Cc2nc(-c3c(F)cccc3F)cs2)cn1.
What is the InChIKey of 3-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one?
The InChIKey is HIMYLCNWVHDCGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F2N3OS/c1-9-5-14(21)20(8-18-9)6-13-19-12(7-22-13)15-10(16)3-2-4-11(15)17/h2-5,7-8H,6H2,1H3.
What are the key properties of 3-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one?
3-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one has a molecular weight of 319.34 g/mol, XLogP of 3.00, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one is sourced from PubChem (CID 86799185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).