C14H16N4O4 — CID 86799222
2-[4-(4-nitrophenyl)pyrazol-1-yl]ethyl N,N-dimethylcarbamate (PubChem CID 86799222) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is 2-[4-(4-nitrophenyl)pyrazol-1-yl]ethyl N,N-dimethylcarbamate.
| Compound Name | 2-[4-(4-nitrophenyl)pyrazol-1-yl]ethyl N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 86799222 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-[4-(4-nitrophenyl)pyrazol-1-yl]ethyl N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)OCCn1cc(-c2ccc([N+](=O)[O-])cc2)cn1 |
| InChI | InChI=1S/C14H16N4O4/c1-16(2)14(19)22-8-7-17-10-12(9-15-17)11-3-5-13(6-4-11)18(20)21/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | JHKCDYWVXONLOH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 90.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|