About 1-[4-[(5-propan-2-yl-1,3-thiazol-2-yl)methylamino]phenyl]imidazolidin-2-one
1-[4-[(5-propan-2-yl-1,3-thiazol-2-yl)methylamino]phenyl]imidazolidin-2-one (PubChem CID 86799406) has the molecular formula C16H20N4OS
and a molecular weight of 316.43 g/mol. Its IUPAC name is 1-[4-[(5-propan-2-yl-1,3-thiazol-2-yl)methylamino]phenyl]imidazolidin-2-one.
Molecular Properties
| Compound Name | 1-[4-[(5-propan-2-yl-1,3-thiazol-2-yl)methylamino]phenyl]imidazolidin-2-one |
| PubChem CID | 86799406 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-[4-[(5-propan-2-yl-1,3-thiazol-2-yl)methylamino]phenyl]imidazolidin-2-one |
| SMILES | CC(C)c1cnc(CNc2ccc(N3CCNC3=O)cc2)s1 |
| InChI | InChI=1S/C16H20N4OS/c1-11(2)14-9-19-15(22-14)10-18-12-3-5-13(6-4-12)20-8-7-17-16(20)21/h3-6,9,11,18H,7-8,10H2,1-2H3,(H,17,21) |
| InChIKey | VLRYYIGUMPMAMJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-[(5-propan-2-yl-1,3-thiazol-2-yl)methylamino]phenyl]imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(5-propan-2-yl-1,3-thiazol-2-yl)methylamino]phenyl]imidazolidin-2-one?
The IUPAC name of 1-[4-[(5-propan-2-yl-1,3-thiazol-2-yl)methylamino]phenyl]imidazolidin-2-one (CID 86799406) is 1-[4-[(5-propan-2-yl-1,3-thiazol-2-yl)methylamino]phenyl]imidazolidin-2-one.
What is the SMILES notation for 1-[4-[(5-propan-2-yl-1,3-thiazol-2-yl)methylamino]phenyl]imidazolidin-2-one?
The canonical SMILES for 1-[4-[(5-propan-2-yl-1,3-thiazol-2-yl)methylamino]phenyl]imidazolidin-2-one is CC(C)c1cnc(CNc2ccc(N3CCNC3=O)cc2)s1.
What is the InChIKey of 1-[4-[(5-propan-2-yl-1,3-thiazol-2-yl)methylamino]phenyl]imidazolidin-2-one?
The InChIKey is VLRYYIGUMPMAMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4OS/c1-11(2)14-9-19-15(22-14)10-18-12-3-5-13(6-4-12)20-8-7-17-16(20)21/h3-6,9,11,18H,7-8,10H2,1-2H3,(H,17,21).
What are the key properties of 1-[4-[(5-propan-2-yl-1,3-thiazol-2-yl)methylamino]phenyl]imidazolidin-2-one?
1-[4-[(5-propan-2-yl-1,3-thiazol-2-yl)methylamino]phenyl]imidazolidin-2-one has a molecular weight of 316.43 g/mol, XLogP of 3.41, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(5-propan-2-yl-1,3-thiazol-2-yl)methylamino]phenyl]imidazolidin-2-one is sourced from PubChem (CID 86799406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).