C16H26N4 — CID 86799432
N-[(2,6-dimethylcyclohex-2-en-1-yl)methyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine (PubChem CID 86799432) has the molecular formula C16H26N4 and a molecular weight of 274.41 g/mol. Its IUPAC name is N-[(2,6-dimethylcyclohex-2-en-1-yl)methyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
| Compound Name | N-[(2,6-dimethylcyclohex-2-en-1-yl)methyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 86799432 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | N-[(2,6-dimethylcyclohex-2-en-1-yl)methyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| SMILES | CC1=CCCC(C)C1CNC1CCCn2nc(C)nc21 |
| InChI | InChI=1S/C16H26N4/c1-11-6-4-7-12(2)14(11)10-17-15-8-5-9-20-16(15)18-13(3)19-20/h6,12,14-15,17H,4-5,7-10H2,1-3H3 |
| InChIKey | MEKGLWAGQJWWNX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|