C18H19NO2 — CID 86799489
N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]-2-prop-2-ynoxyaniline (PubChem CID 86799489) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]-2-prop-2-ynoxyaniline.
| Compound Name | N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]-2-prop-2-ynoxyaniline |
|---|---|
| PubChem CID | 86799489 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]-2-prop-2-ynoxyaniline |
| SMILES | C#CCOc1ccccc1NCc1ccc(C2CC2C)o1 |
| InChI | InChI=1S/C18H19NO2/c1-3-10-20-18-7-5-4-6-16(18)19-12-14-8-9-17(21-14)15-11-13(15)2/h1,4-9,13,15,19H,10-12H2,2H3 |
| InChIKey | YXWQXAXKPFPYLX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|