C16H15F3N2O3 — CID 86799712
3-(5-methylfuran-2-yl)-N-(2,4,5-trifluorophenyl)morpholine-4-carboxamide (PubChem CID 86799712) has the molecular formula C16H15F3N2O3 and a molecular weight of 340.30 g/mol. Its IUPAC name is 3-(5-methylfuran-2-yl)-N-(2,4,5-trifluorophenyl)morpholine-4-carboxamide.
| Compound Name | 3-(5-methylfuran-2-yl)-N-(2,4,5-trifluorophenyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 86799712 |
| Molecular Formula | C16H15F3N2O3 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 3-(5-methylfuran-2-yl)-N-(2,4,5-trifluorophenyl)morpholine-4-carboxamide |
| SMILES | Cc1ccc(C2COCCN2C(=O)Nc2cc(F)c(F)cc2F)o1 |
| InChI | InChI=1S/C16H15F3N2O3/c1-9-2-3-15(24-9)14-8-23-5-4-21(14)16(22)20-13-7-11(18)10(17)6-12(13)19/h2-3,6-7,14H,4-5,8H2,1H3,(H,20,22) |
| InChIKey | QIVYJYYRVSUHRT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|