About N-methyl-3-[(2,4,4-trimethylcyclohexyl)amino]propane-1-sulfonamide
N-methyl-3-[(2,4,4-trimethylcyclohexyl)amino]propane-1-sulfonamide (PubChem CID 86799939) has the molecular formula C13H28N2O2S
and a molecular weight of 276.45 g/mol. Its IUPAC name is N-methyl-3-[(2,4,4-trimethylcyclohexyl)amino]propane-1-sulfonamide.
Molecular Properties
| Compound Name | N-methyl-3-[(2,4,4-trimethylcyclohexyl)amino]propane-1-sulfonamide |
| PubChem CID | 86799939 |
| Molecular Formula | C13H28N2O2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | N-methyl-3-[(2,4,4-trimethylcyclohexyl)amino]propane-1-sulfonamide |
| SMILES | CNS(=O)(=O)CCCNC1CCC(C)(C)CC1C |
| InChI | InChI=1S/C13H28N2O2S/c1-11-10-13(2,3)7-6-12(11)15-8-5-9-18(16,17)14-4/h11-12,14-15H,5-10H2,1-4H3 |
| InChIKey | YRBLQUQCMWXHCS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-3-[(2,4,4-trimethylcyclohexyl)amino]propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-[(2,4,4-trimethylcyclohexyl)amino]propane-1-sulfonamide?
The IUPAC name of N-methyl-3-[(2,4,4-trimethylcyclohexyl)amino]propane-1-sulfonamide (CID 86799939) is N-methyl-3-[(2,4,4-trimethylcyclohexyl)amino]propane-1-sulfonamide.
What is the SMILES notation for N-methyl-3-[(2,4,4-trimethylcyclohexyl)amino]propane-1-sulfonamide?
The canonical SMILES for N-methyl-3-[(2,4,4-trimethylcyclohexyl)amino]propane-1-sulfonamide is CNS(=O)(=O)CCCNC1CCC(C)(C)CC1C.
What is the InChIKey of N-methyl-3-[(2,4,4-trimethylcyclohexyl)amino]propane-1-sulfonamide?
The InChIKey is YRBLQUQCMWXHCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O2S/c1-11-10-13(2,3)7-6-12(11)15-8-5-9-18(16,17)14-4/h11-12,14-15H,5-10H2,1-4H3.
What are the key properties of N-methyl-3-[(2,4,4-trimethylcyclohexyl)amino]propane-1-sulfonamide?
N-methyl-3-[(2,4,4-trimethylcyclohexyl)amino]propane-1-sulfonamide has a molecular weight of 276.45 g/mol, XLogP of 1.73, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-[(2,4,4-trimethylcyclohexyl)amino]propane-1-sulfonamide is sourced from PubChem (CID 86799939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).