About butan-2-ylbenzene
butan-2-ylbenzene (PubChem CID 8680) has the molecular formula C10H14
and a molecular weight of 134.22 g/mol. Its IUPAC name is butan-2-ylbenzene.
Molecular Properties
| Compound Name | butan-2-ylbenzene |
| PubChem CID | 8680 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | butan-2-ylbenzene |
| SMILES | CCC(C)c1ccccc1 |
| InChI | InChI=1S/C10H14/c1-3-9(2)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3 |
| InChIKey | ZJMWRROPUADPEA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze butan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ylbenzene?
The IUPAC name of butan-2-ylbenzene (CID 8680) is butan-2-ylbenzene.
What is the SMILES notation for butan-2-ylbenzene?
The canonical SMILES for butan-2-ylbenzene is CCC(C)c1ccccc1.
What is the InChIKey of butan-2-ylbenzene?
The InChIKey is ZJMWRROPUADPEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14/c1-3-9(2)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3.
What are the key properties of butan-2-ylbenzene?
butan-2-ylbenzene has a molecular weight of 134.22 g/mol, XLogP of 3.20, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ylbenzene is sourced from PubChem (CID 8680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).