About (2S,6R)-2,6-dimethyl-N-(2-methylpyrazol-3-yl)morpholine-4-carboxamide
(2S,6R)-2,6-dimethyl-N-(2-methylpyrazol-3-yl)morpholine-4-carboxamide (PubChem CID 86800094) has the molecular formula C11H18N4O2
and a molecular weight of 238.29 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethyl-N-(2-methylpyrazol-3-yl)morpholine-4-carboxamide.
Molecular Properties
| Compound Name | (2S,6R)-2,6-dimethyl-N-(2-methylpyrazol-3-yl)morpholine-4-carboxamide |
| PubChem CID | 86800094 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (2S,6R)-2,6-dimethyl-N-(2-methylpyrazol-3-yl)morpholine-4-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)Nc2ccnn2C)C[C@H](C)O1 |
| InChI | InChI=1S/C11H18N4O2/c1-8-6-15(7-9(2)17-8)11(16)13-10-4-5-12-14(10)3/h4-5,8-9H,6-7H2,1-3H3,(H,13,16)/t8-,9+ |
| InChIKey | HIGOQTKMAGYXSB-DTORHVGOSA-N |
| XLogP | 1.06 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S,6R)-2,6-dimethyl-N-(2-methylpyrazol-3-yl)morpholine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6R)-2,6-dimethyl-N-(2-methylpyrazol-3-yl)morpholine-4-carboxamide?
The IUPAC name of (2S,6R)-2,6-dimethyl-N-(2-methylpyrazol-3-yl)morpholine-4-carboxamide (CID 86800094) is (2S,6R)-2,6-dimethyl-N-(2-methylpyrazol-3-yl)morpholine-4-carboxamide.
What is the SMILES notation for (2S,6R)-2,6-dimethyl-N-(2-methylpyrazol-3-yl)morpholine-4-carboxamide?
The canonical SMILES for (2S,6R)-2,6-dimethyl-N-(2-methylpyrazol-3-yl)morpholine-4-carboxamide is C[C@@H]1CN(C(=O)Nc2ccnn2C)C[C@H](C)O1.
What is the InChIKey of (2S,6R)-2,6-dimethyl-N-(2-methylpyrazol-3-yl)morpholine-4-carboxamide?
The InChIKey is HIGOQTKMAGYXSB-DTORHVGOSA-N. The full InChI is InChI=1S/C11H18N4O2/c1-8-6-15(7-9(2)17-8)11(16)13-10-4-5-12-14(10)3/h4-5,8-9H,6-7H2,1-3H3,(H,13,16)/t8-,9+.
What are the key properties of (2S,6R)-2,6-dimethyl-N-(2-methylpyrazol-3-yl)morpholine-4-carboxamide?
(2S,6R)-2,6-dimethyl-N-(2-methylpyrazol-3-yl)morpholine-4-carboxamide has a molecular weight of 238.29 g/mol, XLogP of 1.06, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6R)-2,6-dimethyl-N-(2-methylpyrazol-3-yl)morpholine-4-carboxamide is sourced from PubChem (CID 86800094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).