C16H26F3N3O — CID 86800454
N-cyclohex-2-en-1-yl-3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]pyrrolidine-1-carboxamide (PubChem CID 86800454) has the molecular formula C16H26F3N3O and a molecular weight of 333.40 g/mol. Its IUPAC name is N-cyclohex-2-en-1-yl-3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]pyrrolidine-1-carboxamide.
| Compound Name | N-cyclohex-2-en-1-yl-3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 86800454 |
| Molecular Formula | C16H26F3N3O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | N-cyclohex-2-en-1-yl-3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]pyrrolidine-1-carboxamide |
| SMILES | CCN(CC1CCN(C(=O)NC2C=CCCC2)C1)CC(F)(F)F |
| InChI | InChI=1S/C16H26F3N3O/c1-2-21(12-16(17,18)19)10-13-8-9-22(11-13)15(23)20-14-6-4-3-5-7-14/h4,6,13-14H,2-3,5,7-12H2,1H3,(H,20,23) |
| InChIKey | DBEPTORWJYCKFS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|