About (3-methyl-3,4-dihydro-2H-chromen-4-yl) 3-methylimidazo[4,5-b]pyridine-6-carboxylate
(3-methyl-3,4-dihydro-2H-chromen-4-yl) 3-methylimidazo[4,5-b]pyridine-6-carboxylate (PubChem CID 86800875) has the molecular formula C18H17N3O3
and a molecular weight of 323.35 g/mol. Its IUPAC name is (3-methyl-3,4-dihydro-2H-chromen-4-yl) 3-methylimidazo[4,5-b]pyridine-6-carboxylate.
Molecular Properties
| Compound Name | (3-methyl-3,4-dihydro-2H-chromen-4-yl) 3-methylimidazo[4,5-b]pyridine-6-carboxylate |
| PubChem CID | 86800875 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (3-methyl-3,4-dihydro-2H-chromen-4-yl) 3-methylimidazo[4,5-b]pyridine-6-carboxylate |
| SMILES | CC1COc2ccccc2C1OC(=O)c1cnc2c(c1)ncn2C |
| InChI | InChI=1S/C18H17N3O3/c1-11-9-23-15-6-4-3-5-13(15)16(11)24-18(22)12-7-14-17(19-8-12)21(2)10-20-14/h3-8,10-11,16H,9H2,1-2H3 |
| InChIKey | LXXNOBVQINROQJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-methyl-3,4-dihydro-2H-chromen-4-yl) 3-methylimidazo[4,5-b]pyridine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-3,4-dihydro-2H-chromen-4-yl) 3-methylimidazo[4,5-b]pyridine-6-carboxylate?
The IUPAC name of (3-methyl-3,4-dihydro-2H-chromen-4-yl) 3-methylimidazo[4,5-b]pyridine-6-carboxylate (CID 86800875) is (3-methyl-3,4-dihydro-2H-chromen-4-yl) 3-methylimidazo[4,5-b]pyridine-6-carboxylate.
What is the SMILES notation for (3-methyl-3,4-dihydro-2H-chromen-4-yl) 3-methylimidazo[4,5-b]pyridine-6-carboxylate?
The canonical SMILES for (3-methyl-3,4-dihydro-2H-chromen-4-yl) 3-methylimidazo[4,5-b]pyridine-6-carboxylate is CC1COc2ccccc2C1OC(=O)c1cnc2c(c1)ncn2C.
What is the InChIKey of (3-methyl-3,4-dihydro-2H-chromen-4-yl) 3-methylimidazo[4,5-b]pyridine-6-carboxylate?
The InChIKey is LXXNOBVQINROQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O3/c1-11-9-23-15-6-4-3-5-13(15)16(11)24-18(22)12-7-14-17(19-8-12)21(2)10-20-14/h3-8,10-11,16H,9H2,1-2H3.
What are the key properties of (3-methyl-3,4-dihydro-2H-chromen-4-yl) 3-methylimidazo[4,5-b]pyridine-6-carboxylate?
(3-methyl-3,4-dihydro-2H-chromen-4-yl) 3-methylimidazo[4,5-b]pyridine-6-carboxylate has a molecular weight of 323.35 g/mol, XLogP of 2.89, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-3,4-dihydro-2H-chromen-4-yl) 3-methylimidazo[4,5-b]pyridine-6-carboxylate is sourced from PubChem (CID 86800875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).