C12H12BrFO2 — CID 86801392
cyclopropylmethyl 2-(2-bromo-4-fluorophenyl)acetate (PubChem CID 86801392) has the molecular formula C12H12BrFO2 and a molecular weight of 287.13 g/mol. Its IUPAC name is cyclopropylmethyl 2-(2-bromo-4-fluorophenyl)acetate.
| Compound Name | cyclopropylmethyl 2-(2-bromo-4-fluorophenyl)acetate |
|---|---|
| PubChem CID | 86801392 |
| Molecular Formula | C12H12BrFO2 |
| Molecular Weight | 287.13 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | cyclopropylmethyl 2-(2-bromo-4-fluorophenyl)acetate |
| SMILES | O=C(Cc1ccc(F)cc1Br)OCC1CC1 |
| InChI | InChI=1S/C12H12BrFO2/c13-11-6-10(14)4-3-9(11)5-12(15)16-7-8-1-2-8/h3-4,6,8H,1-2,5,7H2 |
| InChIKey | KGLREGCMCOFVRB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.13 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |