C13H14BrN3O3 — CID 86801789
N-(5-bromo-2,4-dimethoxyphenyl)-2-methylpyrazole-3-carboxamide (PubChem CID 86801789) has the molecular formula C13H14BrN3O3 and a molecular weight of 340.18 g/mol. Its IUPAC name is N-(5-bromo-2,4-dimethoxyphenyl)-2-methylpyrazole-3-carboxamide.
| Compound Name | N-(5-bromo-2,4-dimethoxyphenyl)-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 86801789 |
| Molecular Formula | C13H14BrN3O3 |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | N-(5-bromo-2,4-dimethoxyphenyl)-2-methylpyrazole-3-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)c2ccnn2C)cc1Br |
| InChI | InChI=1S/C13H14BrN3O3/c1-17-10(4-5-15-17)13(18)16-9-6-8(14)11(19-2)7-12(9)20-3/h4-7H,1-3H3,(H,16,18) |
| InChIKey | NMSPOWWIDCSGPF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |