About N-[4-[[2-(3,4-difluorophenyl)oxolan-3-yl]amino]cyclohexyl]acetamide
N-[4-[[2-(3,4-difluorophenyl)oxolan-3-yl]amino]cyclohexyl]acetamide (PubChem CID 86802031) has the molecular formula C18H24F2N2O2
and a molecular weight of 338.40 g/mol. Its IUPAC name is N-[4-[[2-(3,4-difluorophenyl)oxolan-3-yl]amino]cyclohexyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[[2-(3,4-difluorophenyl)oxolan-3-yl]amino]cyclohexyl]acetamide |
| PubChem CID | 86802031 |
| Molecular Formula | C18H24F2N2O2 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | N-[4-[[2-(3,4-difluorophenyl)oxolan-3-yl]amino]cyclohexyl]acetamide |
| SMILES | CC(=O)NC1CCC(NC2CCOC2c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C18H24F2N2O2/c1-11(23)21-13-3-5-14(6-4-13)22-17-8-9-24-18(17)12-2-7-15(19)16(20)10-12/h2,7,10,13-14,17-18,22H,3-6,8-9H2,1H3,(H,21,23) |
| InChIKey | PYAOTRVATXGGQH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-[[2-(3,4-difluorophenyl)oxolan-3-yl]amino]cyclohexyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[[2-(3,4-difluorophenyl)oxolan-3-yl]amino]cyclohexyl]acetamide?
The IUPAC name of N-[4-[[2-(3,4-difluorophenyl)oxolan-3-yl]amino]cyclohexyl]acetamide (CID 86802031) is N-[4-[[2-(3,4-difluorophenyl)oxolan-3-yl]amino]cyclohexyl]acetamide.
What is the SMILES notation for N-[4-[[2-(3,4-difluorophenyl)oxolan-3-yl]amino]cyclohexyl]acetamide?
The canonical SMILES for N-[4-[[2-(3,4-difluorophenyl)oxolan-3-yl]amino]cyclohexyl]acetamide is CC(=O)NC1CCC(NC2CCOC2c2ccc(F)c(F)c2)CC1.
What is the InChIKey of N-[4-[[2-(3,4-difluorophenyl)oxolan-3-yl]amino]cyclohexyl]acetamide?
The InChIKey is PYAOTRVATXGGQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24F2N2O2/c1-11(23)21-13-3-5-14(6-4-13)22-17-8-9-24-18(17)12-2-7-15(19)16(20)10-12/h2,7,10,13-14,17-18,22H,3-6,8-9H2,1H3,(H,21,23).
What are the key properties of N-[4-[[2-(3,4-difluorophenyl)oxolan-3-yl]amino]cyclohexyl]acetamide?
N-[4-[[2-(3,4-difluorophenyl)oxolan-3-yl]amino]cyclohexyl]acetamide has a molecular weight of 338.40 g/mol, XLogP of 2.83, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[[2-(3,4-difluorophenyl)oxolan-3-yl]amino]cyclohexyl]acetamide is sourced from PubChem (CID 86802031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).